C9H11N5 — CID 84771120
6-pyrrolidin-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 84771120) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is 6-pyrrolidin-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 6-pyrrolidin-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 84771120 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 6-pyrrolidin-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | c1nc2ncc(C3CCCN3)cn2n1 |
| InChI | InChI=1S/C9H11N5/c1-2-8(10-3-1)7-4-11-9-12-6-13-14(9)5-7/h4-6,8,10H,1-3H2 |
| InChIKey | CSFOWXCKRMPQDD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |