C10H12N4 — CID 130615777
7-[(2R)-pyrrolidin-2-yl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 130615777) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 7-[(2R)-pyrrolidin-2-yl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 7-[(2R)-pyrrolidin-2-yl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 130615777 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 7-[(2R)-pyrrolidin-2-yl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | c1nc2cc([C@H]3CCCN3)ccn2n1 |
| InChI | InChI=1S/C10H12N4/c1-2-9(11-4-1)8-3-5-14-10(6-8)12-7-13-14/h3,5-7,9,11H,1-2,4H2/t9-/m1/s1 |
| InChIKey | ULNKSOAQBVAXQK-SECBINFHSA-N |
| XLogP | 1.15 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |