C10H19N3O — CID 84774558
1-(2-aminoethyl)-3-cyclobutyl-1,3-diazinan-2-one (PubChem CID 84774558) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-cyclobutyl-1,3-diazinan-2-one.
| Compound Name | 1-(2-aminoethyl)-3-cyclobutyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 84774558 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 1-(2-aminoethyl)-3-cyclobutyl-1,3-diazinan-2-one |
| SMILES | NCCN1CCCN(C2CCC2)C1=O |
| InChI | InChI=1S/C10H19N3O/c11-5-8-12-6-2-7-13(10(12)14)9-3-1-4-9/h9H,1-8,11H2 |
| InChIKey | HLABQZLBXDORMI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |