C11H16ClN — CID 84774730
2-(2-chloro-3,5-dimethylphenyl)propan-1-amine (PubChem CID 84774730) has the molecular formula C11H16ClN and a molecular weight of 197.71 g/mol. Its IUPAC name is 2-(2-chloro-3,5-dimethylphenyl)propan-1-amine.
| Compound Name | 2-(2-chloro-3,5-dimethylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 84774730 |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-(2-chloro-3,5-dimethylphenyl)propan-1-amine |
| SMILES | Cc1cc(C)c(Cl)c(C(C)CN)c1 |
| InChI | InChI=1S/C11H16ClN/c1-7-4-8(2)11(12)10(5-7)9(3)6-13/h4-5,9H,6,13H2,1-3H3 |
| InChIKey | MGXPQCBVIFYDLR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.71 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |