C9H8ClF2N — CID 84777571
1-(3-chloro-2,4-difluorophenyl)cyclopropan-1-amine (PubChem CID 84777571) has the molecular formula C9H8ClF2N and a molecular weight of 203.62 g/mol. Its IUPAC name is 1-(3-chloro-2,4-difluorophenyl)cyclopropan-1-amine.
| Compound Name | 1-(3-chloro-2,4-difluorophenyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 84777571 |
| Molecular Formula | C9H8ClF2N |
| Molecular Weight | 203.62 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 1-(3-chloro-2,4-difluorophenyl)cyclopropan-1-amine |
| SMILES | NC1(c2ccc(F)c(Cl)c2F)CC1 |
| InChI | InChI=1S/C9H8ClF2N/c10-7-6(11)2-1-5(8(7)12)9(13)3-4-9/h1-2H,3-4,13H2 |
| InChIKey | XCYJPOIFJMPHBT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.62 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|