C10H10N2OS — CID 84779153
2-(5-amino-2-methyl-1,3-thiazol-4-yl)phenol (PubChem CID 84779153) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-(5-amino-2-methyl-1,3-thiazol-4-yl)phenol.
| Compound Name | 2-(5-amino-2-methyl-1,3-thiazol-4-yl)phenol |
|---|---|
| PubChem CID | 84779153 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2-(5-amino-2-methyl-1,3-thiazol-4-yl)phenol |
| SMILES | Cc1nc(-c2ccccc2O)c(N)s1 |
| InChI | InChI=1S/C10H10N2OS/c1-6-12-9(10(11)14-6)7-4-2-3-5-8(7)13/h2-5,13H,11H2,1H3 |
| InChIKey | KULWMUSKAPKBBS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |