C11H19N3O — CID 84780839
N-[(2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)methyl]-N-methylhydroxylamine (PubChem CID 84780839) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is N-[(2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)methyl]-N-methylhydroxylamine.
| Compound Name | N-[(2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)methyl]-N-methylhydroxylamine |
|---|---|
| PubChem CID | 84780839 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | N-[(2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)methyl]-N-methylhydroxylamine |
| SMILES | CCc1nc2n(c1CN(C)O)CCCC2 |
| InChI | InChI=1S/C11H19N3O/c1-3-9-10(8-13(2)15)14-7-5-4-6-11(14)12-9/h15H,3-8H2,1-2H3 |
| InChIKey | IXGHUDPJKOBUOX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|