3-(fluoromethyl)-1,1-dioxothiane-3-carboxylic acid

C7H11FO4S — CID 84781149

IUPAC3-(fluoromethyl)-1,1-dioxothiane-3-carboxylic acid
SMILESO=C(O)C1(CF)CCCS(=O)(=O)C1
InChIInChI=1S/C7H11FO4S/c8-4-7(6(9)10)2-1-3-13(11,12)5-7/h1-5H2,(H,9,10)
InChIKeySCQFCMMONVAEPO-UHFFFAOYSA-N
MW210.23 g/mol
LogP0.24
Rot. Bonds2

About 3-(fluoromethyl)-1,1-dioxothiane-3-carboxylic acid

3-(fluoromethyl)-1,1-dioxothiane-3-carboxylic acid (PubChem CID 84781149) has the molecular formula C7H11FO4S and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-(fluoromethyl)-1,1-dioxothiane-3-carboxylic acid.

Molecular Properties

Compound Name3-(fluoromethyl)-1,1-dioxothiane-3-carboxylic acid
PubChem CID84781149
Molecular FormulaC7H11FO4S
Molecular Weight210.23 g/mol
Exact Mass210.04
IUPAC Name3-(fluoromethyl)-1,1-dioxothiane-3-carboxylic acid
SMILESO=C(O)C1(CF)CCCS(=O)(=O)C1
InChIInChI=1S/C7H11FO4S/c8-4-7(6(9)10)2-1-3-13(11,12)5-7/h1-5H2,(H,9,10)
InChIKeySCQFCMMONVAEPO-UHFFFAOYSA-N
XLogP0.24
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.23
LogP ≤ 50.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(fluoromethyl)-1,1-dioxothiane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(fluoromethyl)-1,1-dioxothiane-3-carboxylic acid?
The IUPAC name of 3-(fluoromethyl)-1,1-dioxothiane-3-carboxylic acid (CID 84781149) is 3-(fluoromethyl)-1,1-dioxothiane-3-carboxylic acid.
What is the SMILES notation for 3-(fluoromethyl)-1,1-dioxothiane-3-carboxylic acid?
The canonical SMILES for 3-(fluoromethyl)-1,1-dioxothiane-3-carboxylic acid is O=C(O)C1(CF)CCCS(=O)(=O)C1.
What is the InChIKey of 3-(fluoromethyl)-1,1-dioxothiane-3-carboxylic acid?
The InChIKey is SCQFCMMONVAEPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11FO4S/c8-4-7(6(9)10)2-1-3-13(11,12)5-7/h1-5H2,(H,9,10).
What are the key properties of 3-(fluoromethyl)-1,1-dioxothiane-3-carboxylic acid?
3-(fluoromethyl)-1,1-dioxothiane-3-carboxylic acid has a molecular weight of 210.23 g/mol, XLogP of 0.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(fluoromethyl)-1,1-dioxothiane-3-carboxylic acid is sourced from PubChem (CID 84781149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).