C11H14FNO2 — CID 84781540
2-fluoro-4-(pyrrolidin-3-ylmethyl)benzene-1,3-diol (PubChem CID 84781540) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is 2-fluoro-4-(pyrrolidin-3-ylmethyl)benzene-1,3-diol.
| Compound Name | 2-fluoro-4-(pyrrolidin-3-ylmethyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 84781540 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-fluoro-4-(pyrrolidin-3-ylmethyl)benzene-1,3-diol |
| SMILES | Oc1ccc(CC2CCNC2)c(O)c1F |
| InChI | InChI=1S/C11H14FNO2/c12-10-9(14)2-1-8(11(10)15)5-7-3-4-13-6-7/h1-2,7,13-15H,3-6H2 |
| InChIKey | WAMMGXCKTDNHJE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |