C11H14BrNO2 — CID 84809503
5-bromo-3-(pyrrolidin-3-ylmethyl)benzene-1,2-diol (PubChem CID 84809503) has the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. Its IUPAC name is 5-bromo-3-(pyrrolidin-3-ylmethyl)benzene-1,2-diol.
| Compound Name | 5-bromo-3-(pyrrolidin-3-ylmethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 84809503 |
| Molecular Formula | C11H14BrNO2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 5-bromo-3-(pyrrolidin-3-ylmethyl)benzene-1,2-diol |
| SMILES | Oc1cc(Br)cc(CC2CCNC2)c1O |
| InChI | InChI=1S/C11H14BrNO2/c12-9-4-8(11(15)10(14)5-9)3-7-1-2-13-6-7/h4-5,7,13-15H,1-3,6H2 |
| InChIKey | ZBLJRQJQAYNSNS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|