C13H18BrNO — CID 84812896
3-bromo-2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)phenol (PubChem CID 84812896) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is 3-bromo-2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)phenol.
| Compound Name | 3-bromo-2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)phenol |
|---|---|
| PubChem CID | 84812896 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 3-bromo-2,5-dimethyl-6-(pyrrolidin-3-ylmethyl)phenol |
| SMILES | Cc1cc(Br)c(C)c(O)c1CC1CCNC1 |
| InChI | InChI=1S/C13H18BrNO/c1-8-5-12(14)9(2)13(16)11(8)6-10-3-4-15-7-10/h5,10,15-16H,3-4,6-7H2,1-2H3 |
| InChIKey | RBZYVHMSDCOPKW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |