C14H20BrNO — CID 84815947
3-[(2-bromo-6-methoxy-3,5-dimethylphenyl)methyl]pyrrolidine (PubChem CID 84815947) has the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. Its IUPAC name is 3-[(2-bromo-6-methoxy-3,5-dimethylphenyl)methyl]pyrrolidine.
| Compound Name | 3-[(2-bromo-6-methoxy-3,5-dimethylphenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 84815947 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 3-[(2-bromo-6-methoxy-3,5-dimethylphenyl)methyl]pyrrolidine |
| SMILES | COc1c(C)cc(C)c(Br)c1CC1CCNC1 |
| InChI | InChI=1S/C14H20BrNO/c1-9-6-10(2)14(17-3)12(13(9)15)7-11-4-5-16-8-11/h6,11,16H,4-5,7-8H2,1-3H3 |
| InChIKey | OBNWGVPWCBPDMU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |