C11H13F2NO — CID 84782649
2,4-difluoro-6-piperidin-3-ylphenol (PubChem CID 84782649) has the molecular formula C11H13F2NO and a molecular weight of 213.23 g/mol. Its IUPAC name is 2,4-difluoro-6-piperidin-3-ylphenol.
| Compound Name | 2,4-difluoro-6-piperidin-3-ylphenol |
|---|---|
| PubChem CID | 84782649 |
| Molecular Formula | C11H13F2NO |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2,4-difluoro-6-piperidin-3-ylphenol |
| SMILES | Oc1c(F)cc(F)cc1C1CCCNC1 |
| InChI | InChI=1S/C11H13F2NO/c12-8-4-9(11(15)10(13)5-8)7-2-1-3-14-6-7/h4-5,7,14-15H,1-3,6H2 |
| InChIKey | BPCLXSHCXHIQGA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |