C11H14FNO2 — CID 117301308
2-fluoro-5-piperidin-3-ylbenzene-1,4-diol (PubChem CID 117301308) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is 2-fluoro-5-piperidin-3-ylbenzene-1,4-diol.
| Compound Name | 2-fluoro-5-piperidin-3-ylbenzene-1,4-diol |
|---|---|
| PubChem CID | 117301308 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-fluoro-5-piperidin-3-ylbenzene-1,4-diol |
| SMILES | Oc1cc(C2CCCNC2)c(O)cc1F |
| InChI | InChI=1S/C11H14FNO2/c12-9-5-10(14)8(4-11(9)15)7-2-1-3-13-6-7/h4-5,7,13-15H,1-3,6H2 |
| InChIKey | WRLRVYPLHLJCTR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|