C12H12N2O2 — CID 84784689
2-(3-oxo-2,5-diazabicyclo[2.2.1]heptan-2-yl)benzaldehyde (PubChem CID 84784689) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-(3-oxo-2,5-diazabicyclo[2.2.1]heptan-2-yl)benzaldehyde.
| Compound Name | 2-(3-oxo-2,5-diazabicyclo[2.2.1]heptan-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 84784689 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-(3-oxo-2,5-diazabicyclo[2.2.1]heptan-2-yl)benzaldehyde |
| SMILES | O=Cc1ccccc1N1C(=O)C2CC1CN2 |
| InChI | InChI=1S/C12H12N2O2/c15-7-8-3-1-2-4-11(8)14-9-5-10(12(14)16)13-6-9/h1-4,7,9-10,13H,5-6H2 |
| InChIKey | XDRBCWIOXIQQNP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|