C14H22N2 — CID 84786345
2-methyl-3-piperidin-3-yl-4,5,6,7-tetrahydro-1H-indole (PubChem CID 84786345) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-methyl-3-piperidin-3-yl-4,5,6,7-tetrahydro-1H-indole.
| Compound Name | 2-methyl-3-piperidin-3-yl-4,5,6,7-tetrahydro-1H-indole |
|---|---|
| PubChem CID | 84786345 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2-methyl-3-piperidin-3-yl-4,5,6,7-tetrahydro-1H-indole |
| SMILES | Cc1[nH]c2c(c1C1CCCNC1)CCCC2 |
| InChI | InChI=1S/C14H22N2/c1-10-14(11-5-4-8-15-9-11)12-6-2-3-7-13(12)16-10/h11,15-16H,2-9H2,1H3 |
| InChIKey | SGXXMFBNBIMIKK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |