C11H17N3S — CID 105481259
4,6-dimethyl-5-piperidin-3-yl-1H-pyrimidine-2-thione (PubChem CID 105481259) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is 4,6-dimethyl-5-piperidin-3-yl-1H-pyrimidine-2-thione.
| Compound Name | 4,6-dimethyl-5-piperidin-3-yl-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 105481259 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 4,6-dimethyl-5-piperidin-3-yl-1H-pyrimidine-2-thione |
| SMILES | Cc1nc(=S)[nH]c(C)c1C1CCCNC1 |
| InChI | InChI=1S/C11H17N3S/c1-7-10(8(2)14-11(15)13-7)9-4-3-5-12-6-9/h9,12H,3-6H2,1-2H3,(H,13,14,15) |
| InChIKey | YIVRKYSNQKWGGS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|