C11H12N2O3 — CID 84787310
5-morpholin-3-yl-1,3-benzoxazol-4-ol (PubChem CID 84787310) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 5-morpholin-3-yl-1,3-benzoxazol-4-ol.
| Compound Name | 5-morpholin-3-yl-1,3-benzoxazol-4-ol |
|---|---|
| PubChem CID | 84787310 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 5-morpholin-3-yl-1,3-benzoxazol-4-ol |
| SMILES | Oc1c(C2COCCN2)ccc2ocnc12 |
| InChI | InChI=1S/C11H12N2O3/c14-11-7(8-5-15-4-3-12-8)1-2-9-10(11)13-6-16-9/h1-2,6,8,12,14H,3-5H2 |
| InChIKey | DESDNJQTIGGQFA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|