C6H9N3O2 — CID 71757676
3-(1,2,4-oxadiazol-3-yl)morpholine (PubChem CID 71757676) has the molecular formula C6H9N3O2 and a molecular weight of 155.16 g/mol. Its IUPAC name is 3-(1,2,4-oxadiazol-3-yl)morpholine.
| Compound Name | 3-(1,2,4-oxadiazol-3-yl)morpholine |
|---|---|
| PubChem CID | 71757676 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 3-(1,2,4-oxadiazol-3-yl)morpholine |
| SMILES | c1nc(C2COCCN2)no1 |
| InChI | InChI=1S/C6H9N3O2/c1-2-10-3-5(7-1)6-8-4-11-9-6/h4-5,7H,1-3H2 |
| InChIKey | UPVZMHVVZBKTBX-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |