C13H16N4 — CID 84792284
4-(piperazin-1-ylmethyl)-2,6-naphthyridine (PubChem CID 84792284) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 4-(piperazin-1-ylmethyl)-2,6-naphthyridine.
| Compound Name | 4-(piperazin-1-ylmethyl)-2,6-naphthyridine |
|---|---|
| PubChem CID | 84792284 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 4-(piperazin-1-ylmethyl)-2,6-naphthyridine |
| SMILES | c1cc2cncc(CN3CCNCC3)c2cn1 |
| InChI | InChI=1S/C13H16N4/c1-2-15-9-13-11(1)7-16-8-12(13)10-17-5-3-14-4-6-17/h1-2,7-9,14H,3-6,10H2 |
| InChIKey | FDDBPMGCFYWVCP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |