C12H13NO4 — CID 84797262
6-aminospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-carboxylic acid (PubChem CID 84797262) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 6-aminospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-carboxylic acid.
| Compound Name | 6-aminospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-carboxylic acid |
|---|---|
| PubChem CID | 84797262 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 6-aminospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-carboxylic acid |
| SMILES | Nc1cc2c(cc1C(=O)O)OC1(CCCC1)O2 |
| InChI | InChI=1S/C12H13NO4/c13-8-6-10-9(5-7(8)11(14)15)16-12(17-10)3-1-2-4-12/h5-6H,1-4,13H2,(H,14,15) |
| InChIKey | AVBBJBUTFGZXBV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|