C12H13FN2O2 — CID 84798035
3-(6-fluoro-1-methylpyrrolo[3,2-b]pyridin-2-yl)butanoic acid (PubChem CID 84798035) has the molecular formula C12H13FN2O2 and a molecular weight of 236.25 g/mol. Its IUPAC name is 3-(6-fluoro-1-methylpyrrolo[3,2-b]pyridin-2-yl)butanoic acid.
| Compound Name | 3-(6-fluoro-1-methylpyrrolo[3,2-b]pyridin-2-yl)butanoic acid |
|---|---|
| PubChem CID | 84798035 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-(6-fluoro-1-methylpyrrolo[3,2-b]pyridin-2-yl)butanoic acid |
| SMILES | CC(CC(=O)O)c1cc2ncc(F)cc2n1C |
| InChI | InChI=1S/C12H13FN2O2/c1-7(3-12(16)17)10-5-9-11(15(10)2)4-8(13)6-14-9/h4-7H,3H2,1-2H3,(H,16,17) |
| InChIKey | WKBCLGKWJMSHDB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |