C11H18F2O3 — CID 84798066
methyl 3-butyl-4,4-difluorooxane-3-carboxylate (PubChem CID 84798066) has the molecular formula C11H18F2O3 and a molecular weight of 236.26 g/mol. Its IUPAC name is methyl 3-butyl-4,4-difluorooxane-3-carboxylate.
| Compound Name | methyl 3-butyl-4,4-difluorooxane-3-carboxylate |
|---|---|
| PubChem CID | 84798066 |
| Molecular Formula | C11H18F2O3 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | methyl 3-butyl-4,4-difluorooxane-3-carboxylate |
| SMILES | CCCCC1(C(=O)OC)COCCC1(F)F |
| InChI | InChI=1S/C11H18F2O3/c1-3-4-5-10(9(14)15-2)8-16-7-6-11(10,12)13/h3-8H2,1-2H3 |
| InChIKey | KPYHKBRJCPWLFV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |