C11H10ClNOS — CID 84800025
5-(2-chlorophenyl)-2-thia-5-azabicyclo[2.2.1]heptan-6-one (PubChem CID 84800025) has the molecular formula C11H10ClNOS and a molecular weight of 239.73 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-2-thia-5-azabicyclo[2.2.1]heptan-6-one.
| Compound Name | 5-(2-chlorophenyl)-2-thia-5-azabicyclo[2.2.1]heptan-6-one |
|---|---|
| PubChem CID | 84800025 |
| Molecular Formula | C11H10ClNOS |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 5-(2-chlorophenyl)-2-thia-5-azabicyclo[2.2.1]heptan-6-one |
| SMILES | O=C1C2CC(CS2)N1c1ccccc1Cl |
| InChI | InChI=1S/C11H10ClNOS/c12-8-3-1-2-4-9(8)13-7-5-10(11(13)14)15-6-7/h1-4,7,10H,5-6H2 |
| InChIKey | BEIQOXCNKRNWHD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |