C10H12BrNO — CID 84801504
2-amino-1-(2-bromo-4,6-dimethylphenyl)ethanone (PubChem CID 84801504) has the molecular formula C10H12BrNO and a molecular weight of 242.12 g/mol. Its IUPAC name is 2-amino-1-(2-bromo-4,6-dimethylphenyl)ethanone.
| Compound Name | 2-amino-1-(2-bromo-4,6-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 84801504 |
| Molecular Formula | C10H12BrNO |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 2-amino-1-(2-bromo-4,6-dimethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(C(=O)CN)c(Br)c1 |
| InChI | InChI=1S/C10H12BrNO/c1-6-3-7(2)10(8(11)4-6)9(13)5-12/h3-4H,5,12H2,1-2H3 |
| InChIKey | ZZFIDDGFAHKXFU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |