C9H10ClNO3 — CID 117307262
2-amino-1-(2-chloro-3,4-dihydroxy-6-methylphenyl)ethanone (PubChem CID 117307262) has the molecular formula C9H10ClNO3 and a molecular weight of 215.64 g/mol. Its IUPAC name is 2-amino-1-(2-chloro-3,4-dihydroxy-6-methylphenyl)ethanone.
| Compound Name | 2-amino-1-(2-chloro-3,4-dihydroxy-6-methylphenyl)ethanone |
|---|---|
| PubChem CID | 117307262 |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 2-amino-1-(2-chloro-3,4-dihydroxy-6-methylphenyl)ethanone |
| SMILES | Cc1cc(O)c(O)c(Cl)c1C(=O)CN |
| InChI | InChI=1S/C9H10ClNO3/c1-4-2-5(12)9(14)8(10)7(4)6(13)3-11/h2,12,14H,3,11H2,1H3 |
| InChIKey | PMEUIXDOBJKJQV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|