C12H15F2NOS — CID 84806190
2-[4-(2,2-difluoroethylsulfanyl)phenyl]morpholine (PubChem CID 84806190) has the molecular formula C12H15F2NOS and a molecular weight of 259.32 g/mol. Its IUPAC name is 2-[4-(2,2-difluoroethylsulfanyl)phenyl]morpholine.
| Compound Name | 2-[4-(2,2-difluoroethylsulfanyl)phenyl]morpholine |
|---|---|
| PubChem CID | 84806190 |
| Molecular Formula | C12H15F2NOS |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-[4-(2,2-difluoroethylsulfanyl)phenyl]morpholine |
| SMILES | FC(F)CSc1ccc(C2CNCCO2)cc1 |
| InChI | InChI=1S/C12H15F2NOS/c13-12(14)8-17-10-3-1-9(2-4-10)11-7-15-5-6-16-11/h1-4,11-12,15H,5-8H2 |
| InChIKey | SEFZNMAGHPLXJB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |