About 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride
3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride (PubChem CID 84807137) has the molecular formula C6H2Cl2F2O3S
and a molecular weight of 263.05 g/mol. Its IUPAC name is 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride |
| PubChem CID | 84807137 |
| Molecular Formula | C6H2Cl2F2O3S |
| Molecular Weight | 263.05 g/mol |
| Exact Mass | 261.91 |
| IUPAC Name | 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1c(F)cc(O)c(Cl)c1F |
| InChI | InChI=1S/C6H2Cl2F2O3S/c7-4-3(11)1-2(9)6(5(4)10)14(8,12)13/h1,11H |
| InChIKey | SZCVZIVZTLQYTN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.05 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride?
The IUPAC name of 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride (CID 84807137) is 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride.
What is the SMILES notation for 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride?
The canonical SMILES for 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride is O=S(=O)(Cl)c1c(F)cc(O)c(Cl)c1F.
What is the InChIKey of 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride?
The InChIKey is SZCVZIVZTLQYTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Cl2F2O3S/c7-4-3(11)1-2(9)6(5(4)10)14(8,12)13/h1,11H.
What are the key properties of 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride?
3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride has a molecular weight of 263.05 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride is sourced from PubChem (CID 84807137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).