3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride

C6H2Cl2F2O3S — CID 84807137

IUPAC3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1c(F)cc(O)c(Cl)c1F
InChIInChI=1S/C6H2Cl2F2O3S/c7-4-3(11)1-2(9)6(5(4)10)14(8,12)13/h1,11H
InChIKeySZCVZIVZTLQYTN-UHFFFAOYSA-N
MW263.05 g/mol
LogP2.25
Rot. Bonds1

About 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride

3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride (PubChem CID 84807137) has the molecular formula C6H2Cl2F2O3S and a molecular weight of 263.05 g/mol. Its IUPAC name is 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride.

Molecular Properties

Compound Name3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride
PubChem CID84807137
Molecular FormulaC6H2Cl2F2O3S
Molecular Weight263.05 g/mol
Exact Mass261.91
IUPAC Name3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1c(F)cc(O)c(Cl)c1F
InChIInChI=1S/C6H2Cl2F2O3S/c7-4-3(11)1-2(9)6(5(4)10)14(8,12)13/h1,11H
InChIKeySZCVZIVZTLQYTN-UHFFFAOYSA-N
XLogP2.25
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.05
LogP ≤ 52.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3,5-Dichloro-4-hydroxybenzenesulphonic acid
CID 91397
Benzenesulfonyl fluoride, 2,5-dichloro-4-hydroxy-
CID 99191
3,5-Dichloro-4-hydroxybenzene-1-sulfonamide
CID 12526990
Phenol, 2-chloro-4-(methylsulfonyl)-
CID 210099
3,5-Dichloro-4-hydroxybenzene-1-sulfonyl chloride
CID 2735994
3-Chloro-4-hydroxybenzene-1-sulfonamide
CID 304037
3-Chloro-4-hydroxybenzene-1-sulfonyl chloride
CID 22999325
3-Chloro-2-hydroxybenzene-1-sulfonyl chloride
CID 55280569
3-Chloro-4-hydroxy benzenesulphonic acid
CID 14006934
E5V6WN7Jjc
CID 12527023
3,5-Dichloro-4-hydroxybenzenesulfinoperoxoic acid
CID 253218
5-Chloro-4-hydroxybenzene-1,3-disulfonyl difluoride
CID 305698

Frequently Asked Questions

What is the IUPAC name of 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride?
The IUPAC name of 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride (CID 84807137) is 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride.
What is the SMILES notation for 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride?
The canonical SMILES for 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride is O=S(=O)(Cl)c1c(F)cc(O)c(Cl)c1F.
What is the InChIKey of 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride?
The InChIKey is SZCVZIVZTLQYTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Cl2F2O3S/c7-4-3(11)1-2(9)6(5(4)10)14(8,12)13/h1,11H.
What are the key properties of 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride?
3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride has a molecular weight of 263.05 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,6-difluoro-4-hydroxybenzenesulfonyl chloride is sourced from PubChem (CID 84807137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).