C12H12BrNO — CID 84807798
2-bromo-5-(1-isocyanatocyclopropyl)-1,3-dimethylbenzene (PubChem CID 84807798) has the molecular formula C12H12BrNO and a molecular weight of 266.14 g/mol. Its IUPAC name is 2-bromo-5-(1-isocyanatocyclopropyl)-1,3-dimethylbenzene.
| Compound Name | 2-bromo-5-(1-isocyanatocyclopropyl)-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 84807798 |
| Molecular Formula | C12H12BrNO |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 2-bromo-5-(1-isocyanatocyclopropyl)-1,3-dimethylbenzene |
| SMILES | Cc1cc(C2(N=C=O)CC2)cc(C)c1Br |
| InChI | InChI=1S/C12H12BrNO/c1-8-5-10(6-9(2)11(8)13)12(3-4-12)14-7-15/h5-6H,3-4H2,1-2H3 |
| InChIKey | QWDOQWZNZTUREC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|