C14H18N2O — CID 117112559
5-(1-isocyanatocyclopropyl)-N,N,2,3-tetramethylaniline (PubChem CID 117112559) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 5-(1-isocyanatocyclopropyl)-N,N,2,3-tetramethylaniline.
| Compound Name | 5-(1-isocyanatocyclopropyl)-N,N,2,3-tetramethylaniline |
|---|---|
| PubChem CID | 117112559 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 5-(1-isocyanatocyclopropyl)-N,N,2,3-tetramethylaniline |
| SMILES | Cc1cc(C2(N=C=O)CC2)cc(N(C)C)c1C |
| InChI | InChI=1S/C14H18N2O/c1-10-7-12(14(5-6-14)15-9-17)8-13(11(10)2)16(3)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | YKFSBEBPMOLTLN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|