C19H26N2O3 — CID 117112680
tert-butyl N-[5-(1-isocyanatocyclopentyl)-2,3-dimethylphenyl]carbamate (PubChem CID 117112680) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl N-[5-(1-isocyanatocyclopentyl)-2,3-dimethylphenyl]carbamate.
| Compound Name | tert-butyl N-[5-(1-isocyanatocyclopentyl)-2,3-dimethylphenyl]carbamate |
|---|---|
| PubChem CID | 117112680 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | tert-butyl N-[5-(1-isocyanatocyclopentyl)-2,3-dimethylphenyl]carbamate |
| SMILES | Cc1cc(C2(N=C=O)CCCC2)cc(NC(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C19H26N2O3/c1-13-10-15(19(20-12-22)8-6-7-9-19)11-16(14(13)2)21-17(23)24-18(3,4)5/h10-11H,6-9H2,1-5H3,(H,21,23) |
| InChIKey | OVXPYLSAXANPOT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|