C16H19FN2O3 — CID 117491538
tert-butyl N-[2-fluoro-5-(1-isocyanatocyclobutyl)phenyl]carbamate (PubChem CID 117491538) has the molecular formula C16H19FN2O3 and a molecular weight of 306.34 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-5-(1-isocyanatocyclobutyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-5-(1-isocyanatocyclobutyl)phenyl]carbamate |
|---|---|
| PubChem CID | 117491538 |
| Molecular Formula | C16H19FN2O3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | tert-butyl N-[2-fluoro-5-(1-isocyanatocyclobutyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C2(N=C=O)CCC2)ccc1F |
| InChI | InChI=1S/C16H19FN2O3/c1-15(2,3)22-14(21)19-13-9-11(5-6-12(13)17)16(18-10-20)7-4-8-16/h5-6,9H,4,7-8H2,1-3H3,(H,19,21) |
| InChIKey | MXQUJHCLNSILIC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|