C16H20N2O4 — CID 117489643
tert-butyl N-[2-hydroxy-6-(1-isocyanatocyclobutyl)phenyl]carbamate (PubChem CID 117489643) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is tert-butyl N-[2-hydroxy-6-(1-isocyanatocyclobutyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-hydroxy-6-(1-isocyanatocyclobutyl)phenyl]carbamate |
|---|---|
| PubChem CID | 117489643 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | tert-butyl N-[2-hydroxy-6-(1-isocyanatocyclobutyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1c(O)cccc1C1(N=C=O)CCC1 |
| InChI | InChI=1S/C16H20N2O4/c1-15(2,3)22-14(21)18-13-11(6-4-7-12(13)20)16(17-10-19)8-5-9-16/h4,6-7,20H,5,8-9H2,1-3H3,(H,18,21) |
| InChIKey | RGBDWIIMSJMVTR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|