C14H17NO4S — CID 84815517
3-(1,3-dihydroisoindol-2-yl)-1,1-dioxothiane-3-carboxylic acid (PubChem CID 84815517) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is 3-(1,3-dihydroisoindol-2-yl)-1,1-dioxothiane-3-carboxylic acid.
| Compound Name | 3-(1,3-dihydroisoindol-2-yl)-1,1-dioxothiane-3-carboxylic acid |
|---|---|
| PubChem CID | 84815517 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 3-(1,3-dihydroisoindol-2-yl)-1,1-dioxothiane-3-carboxylic acid |
| SMILES | O=C(O)C1(N2Cc3ccccc3C2)CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H17NO4S/c16-13(17)14(6-3-7-20(18,19)10-14)15-8-11-4-1-2-5-12(11)9-15/h1-2,4-5H,3,6-10H2,(H,16,17) |
| InChIKey | MYNOOVAGBGSJEQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |