3-(1,3-dihydroisoindol-2-yl)thietane-3-carboxylic acid

C12H13NO2S — CID 105496523

IUPAC3-(1,3-dihydroisoindol-2-yl)thietane-3-carboxylic acid
SMILESO=C(O)C1(N2Cc3ccccc3C2)CSC1
InChIInChI=1S/C12H13NO2S/c14-11(15)12(7-16-8-12)13-5-9-3-1-2-4-10(9)6-13/h1-4H,5-8H2,(H,14,15)
InChIKeyAIYFWKVOVMMLFH-UHFFFAOYSA-N
MW235.31 g/mol
LogP1.57
Rot. Bonds2

About 3-(1,3-dihydroisoindol-2-yl)thietane-3-carboxylic acid

3-(1,3-dihydroisoindol-2-yl)thietane-3-carboxylic acid (PubChem CID 105496523) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 3-(1,3-dihydroisoindol-2-yl)thietane-3-carboxylic acid.

Molecular Properties

Compound Name3-(1,3-dihydroisoindol-2-yl)thietane-3-carboxylic acid
PubChem CID105496523
Molecular FormulaC12H13NO2S
Molecular Weight235.31 g/mol
Exact Mass235.07
IUPAC Name3-(1,3-dihydroisoindol-2-yl)thietane-3-carboxylic acid
SMILESO=C(O)C1(N2Cc3ccccc3C2)CSC1
InChIInChI=1S/C12H13NO2S/c14-11(15)12(7-16-8-12)13-5-9-3-1-2-4-10(9)6-13/h1-4H,5-8H2,(H,14,15)
InChIKeyAIYFWKVOVMMLFH-UHFFFAOYSA-N
XLogP1.57
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.31
LogP ≤ 51.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(1,3-dihydroisoindol-2-yl)thietane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,3-dihydroisoindol-2-yl)thietane-3-carboxylic acid?
The IUPAC name of 3-(1,3-dihydroisoindol-2-yl)thietane-3-carboxylic acid (CID 105496523) is 3-(1,3-dihydroisoindol-2-yl)thietane-3-carboxylic acid.
What is the SMILES notation for 3-(1,3-dihydroisoindol-2-yl)thietane-3-carboxylic acid?
The canonical SMILES for 3-(1,3-dihydroisoindol-2-yl)thietane-3-carboxylic acid is O=C(O)C1(N2Cc3ccccc3C2)CSC1.
What is the InChIKey of 3-(1,3-dihydroisoindol-2-yl)thietane-3-carboxylic acid?
The InChIKey is AIYFWKVOVMMLFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2S/c14-11(15)12(7-16-8-12)13-5-9-3-1-2-4-10(9)6-13/h1-4H,5-8H2,(H,14,15).
What are the key properties of 3-(1,3-dihydroisoindol-2-yl)thietane-3-carboxylic acid?
3-(1,3-dihydroisoindol-2-yl)thietane-3-carboxylic acid has a molecular weight of 235.31 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dihydroisoindol-2-yl)thietane-3-carboxylic acid is sourced from PubChem (CID 105496523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).