C15H20N4 — CID 84817313
2-[3-(dimethylamino)propylamino]-2-(1H-indol-3-yl)acetonitrile (PubChem CID 84817313) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propylamino]-2-(1H-indol-3-yl)acetonitrile.
| Compound Name | 2-[3-(dimethylamino)propylamino]-2-(1H-indol-3-yl)acetonitrile |
|---|---|
| PubChem CID | 84817313 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-[3-(dimethylamino)propylamino]-2-(1H-indol-3-yl)acetonitrile |
| SMILES | CN(C)CCCNC(C#N)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H20N4/c1-19(2)9-5-8-17-15(10-16)13-11-18-14-7-4-3-6-12(13)14/h3-4,6-7,11,15,17-18H,5,8-9H2,1-2H3 |
| InChIKey | KOWUVHRZDPGLEQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|