C11H12BrNO2S — CID 84818067
3-[(4-bromophenyl)methyl]-1,3-thiazolidine-2-carboxylic acid (PubChem CID 84818067) has the molecular formula C11H12BrNO2S and a molecular weight of 302.19 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methyl]-1,3-thiazolidine-2-carboxylic acid.
| Compound Name | 3-[(4-bromophenyl)methyl]-1,3-thiazolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 84818067 |
| Molecular Formula | C11H12BrNO2S |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | 3-[(4-bromophenyl)methyl]-1,3-thiazolidine-2-carboxylic acid |
| SMILES | O=C(O)C1SCCN1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C11H12BrNO2S/c12-9-3-1-8(2-4-9)7-13-5-6-16-10(13)11(14)15/h1-4,10H,5-7H2,(H,14,15) |
| InChIKey | LUHFVUXXWGTHNR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |