C15H15N5O3 — CID 84818478
4-[4-(3-hydroxypropylamino)pyrazolo[3,4-d]pyrimidin-1-yl]benzoic acid (PubChem CID 84818478) has the molecular formula C15H15N5O3 and a molecular weight of 313.32 g/mol. Its IUPAC name is 4-[4-(3-hydroxypropylamino)pyrazolo[3,4-d]pyrimidin-1-yl]benzoic acid.
| Compound Name | 4-[4-(3-hydroxypropylamino)pyrazolo[3,4-d]pyrimidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 84818478 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 4-[4-(3-hydroxypropylamino)pyrazolo[3,4-d]pyrimidin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-n2ncc3c(NCCCO)ncnc32)cc1 |
| InChI | InChI=1S/C15H15N5O3/c21-7-1-6-16-13-12-8-19-20(14(12)18-9-17-13)11-4-2-10(3-5-11)15(22)23/h2-5,8-9,21H,1,6-7H2,(H,22,23)(H,16,17,18) |
| InChIKey | ZDBVAJJQLSVBJG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|