C19H23N3O2S — CID 8500043
4-[[(4-methoxyphenyl)methylcarbamothioyl-methylamino]methyl]-N-methylbenzamide (PubChem CID 8500043) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 4-[[(4-methoxyphenyl)methylcarbamothioyl-methylamino]methyl]-N-methylbenzamide.
| Compound Name | 4-[[(4-methoxyphenyl)methylcarbamothioyl-methylamino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 8500043 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 4-[[(4-methoxyphenyl)methylcarbamothioyl-methylamino]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(CN(C)C(=S)NCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H23N3O2S/c1-20-18(23)16-8-4-15(5-9-16)13-22(2)19(25)21-12-14-6-10-17(24-3)11-7-14/h4-11H,12-13H2,1-3H3,(H,20,23)(H,21,25) |
| InChIKey | AAMWBLNZGDKRKI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|