About 4-chloro-N'-(4-fluorophenyl)sulfonylbenzohydrazide
4-chloro-N'-(4-fluorophenyl)sulfonylbenzohydrazide (PubChem CID 8500423) has the molecular formula C13H10ClFN2O3S
and a molecular weight of 328.75 g/mol. Its IUPAC name is 4-chloro-N'-(4-fluorophenyl)sulfonylbenzohydrazide.
Molecular Properties
| Compound Name | 4-chloro-N'-(4-fluorophenyl)sulfonylbenzohydrazide |
| PubChem CID | 8500423 |
| Molecular Formula | C13H10ClFN2O3S |
| Molecular Weight | 328.75 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 4-chloro-N'-(4-fluorophenyl)sulfonylbenzohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc(F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H10ClFN2O3S/c14-10-3-1-9(2-4-10)13(18)16-17-21(19,20)12-7-5-11(15)6-8-12/h1-8,17H,(H,16,18) |
| InChIKey | HTHDXTKQSVDQIV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.75 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N'-(4-fluorophenyl)sulfonylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N'-(4-fluorophenyl)sulfonylbenzohydrazide?
The IUPAC name of 4-chloro-N'-(4-fluorophenyl)sulfonylbenzohydrazide (CID 8500423) is 4-chloro-N'-(4-fluorophenyl)sulfonylbenzohydrazide.
What is the SMILES notation for 4-chloro-N'-(4-fluorophenyl)sulfonylbenzohydrazide?
The canonical SMILES for 4-chloro-N'-(4-fluorophenyl)sulfonylbenzohydrazide is O=C(NNS(=O)(=O)c1ccc(F)cc1)c1ccc(Cl)cc1.
What is the InChIKey of 4-chloro-N'-(4-fluorophenyl)sulfonylbenzohydrazide?
The InChIKey is HTHDXTKQSVDQIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClFN2O3S/c14-10-3-1-9(2-4-10)13(18)16-17-21(19,20)12-7-5-11(15)6-8-12/h1-8,17H,(H,16,18).
What are the key properties of 4-chloro-N'-(4-fluorophenyl)sulfonylbenzohydrazide?
4-chloro-N'-(4-fluorophenyl)sulfonylbenzohydrazide has a molecular weight of 328.75 g/mol, XLogP of 2.10, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N'-(4-fluorophenyl)sulfonylbenzohydrazide is sourced from PubChem (CID 8500423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).