C14H11Cl2FN2O4S — CID 8501184
2,5-dichloro-N-(4-fluoro-3-nitrophenyl)-3,6-dimethylbenzenesulfonamide (PubChem CID 8501184) has the molecular formula C14H11Cl2FN2O4S and a molecular weight of 393.22 g/mol. Its IUPAC name is 2,5-dichloro-N-(4-fluoro-3-nitrophenyl)-3,6-dimethylbenzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(4-fluoro-3-nitrophenyl)-3,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 8501184 |
| Molecular Formula | C14H11Cl2FN2O4S |
| Molecular Weight | 393.22 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | 2,5-dichloro-N-(4-fluoro-3-nitrophenyl)-3,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(Cl)c(C)c(S(=O)(=O)Nc2ccc(F)c([N+](=O)[O-])c2)c1Cl |
| InChI | InChI=1S/C14H11Cl2FN2O4S/c1-7-5-10(15)8(2)14(13(7)16)24(22,23)18-9-3-4-11(17)12(6-9)19(20)21/h3-6,18H,1-2H3 |
| InChIKey | UWFFUFFGFFMCBI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.22 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|