C14H11Cl2F2NO2S — CID 8500581
2,5-dichloro-N-(2,4-difluorophenyl)-3,6-dimethylbenzenesulfonamide (PubChem CID 8500581) has the molecular formula C14H11Cl2F2NO2S and a molecular weight of 366.22 g/mol. Its IUPAC name is 2,5-dichloro-N-(2,4-difluorophenyl)-3,6-dimethylbenzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(2,4-difluorophenyl)-3,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 8500581 |
| Molecular Formula | C14H11Cl2F2NO2S |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 2,5-dichloro-N-(2,4-difluorophenyl)-3,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(Cl)c(C)c(S(=O)(=O)Nc2ccc(F)cc2F)c1Cl |
| InChI | InChI=1S/C14H11Cl2F2NO2S/c1-7-5-10(15)8(2)14(13(7)16)22(20,21)19-12-4-3-9(17)6-11(12)18/h3-6,19H,1-2H3 |
| InChIKey | JEMMZBXFNXLDAL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |