C13H11Cl3N2O2S — CID 26969811
2,5-dichloro-N-(2-chloro-3-pyridinyl)-3,6-dimethylbenzenesulfonamide (PubChem CID 26969811) has the molecular formula C13H11Cl3N2O2S and a molecular weight of 365.67 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-chloro-3-pyridinyl)-3,6-dimethylbenzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(2-chloro-3-pyridinyl)-3,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 26969811 |
| Molecular Formula | C13H11Cl3N2O2S |
| Molecular Weight | 365.67 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | 2,5-dichloro-N-(2-chloro-3-pyridinyl)-3,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(Cl)c(C)c(S(=O)(=O)Nc2cccnc2Cl)c1Cl |
| InChI | InChI=1S/C13H11Cl3N2O2S/c1-7-6-9(14)8(2)12(11(7)15)21(19,20)18-10-4-3-5-17-13(10)16/h3-6,18H,1-2H3 |
| InChIKey | SIESHZSBOSGAKM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.67 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|