C45H43N5OS — CID 85028100
methyl N-[2-(N-benzoyl-4-methylanilino)-1,2-bis(N-methylanilino)ethenyl]-N-(4-methylphenyl)-N'-phenylcarbamimidothioate (PubChem CID 85028100) has the molecular formula C45H43N5OS and a molecular weight of 701.94 g/mol. Its IUPAC name is methyl N-[2-(N-benzoyl-4-methylanilino)-1,2-bis(N-methylanilino)ethenyl]-N-(4-methylphenyl)-N'-phenylcarbamimidothioate.
| Compound Name | methyl N-[2-(N-benzoyl-4-methylanilino)-1,2-bis(N-methylanilino)ethenyl]-N-(4-methylphenyl)-N'-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 85028100 |
| Molecular Formula | C45H43N5OS |
| Molecular Weight | 701.94 g/mol |
| Exact Mass | 701.32 |
| IUPAC Name | methyl N-[2-(N-benzoyl-4-methylanilino)-1,2-bis(N-methylanilino)ethenyl]-N-(4-methylphenyl)-N'-phenylcarbamimidothioate |
| SMILES | CS/C(=N\c1ccccc1)N(C(=C(N(C)c1ccccc1)N(C(=O)c1ccccc1)c1ccc(C)cc1)N(C)c1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C45H43N5OS/c1-34-26-30-40(31-27-34)49(44(51)36-18-10-6-11-19-36)42(47(3)38-22-14-8-15-23-38)43(48(4)39-24-16-9-17-25-39)50(41-32-28-35(2)29-33-41)45(52-5)46-37-20-12-7-13-21-37/h6-33H,1-5H3/b43-42?,46-45- |
| InChIKey | AUVGWOPAWXVHRI-QJILOZKESA-N |
| XLogP | 10.91 |
| TPSA | 42.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.94 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|