C21H26N2O2 — CID 8503741
4-[[2-(3,4-dimethylphenyl)acetyl]amino]-N,N-diethylbenzamide (PubChem CID 8503741) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 4-[[2-(3,4-dimethylphenyl)acetyl]amino]-N,N-diethylbenzamide.
| Compound Name | 4-[[2-(3,4-dimethylphenyl)acetyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 8503741 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 4-[[2-(3,4-dimethylphenyl)acetyl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)Cc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C21H26N2O2/c1-5-23(6-2)21(25)18-9-11-19(12-10-18)22-20(24)14-17-8-7-15(3)16(4)13-17/h7-13H,5-6,14H2,1-4H3,(H,22,24) |
| InChIKey | HSAHHLRSIFSEML-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |