C18H18F3N4O3+ — CID 8504178
(3-methyl-4-nitrophenyl)-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]methanone (PubChem CID 8504178) has the molecular formula C18H18F3N4O3+ and a molecular weight of 395.36 g/mol. Its IUPAC name is (3-methyl-4-nitrophenyl)-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]methanone.
| Compound Name | (3-methyl-4-nitrophenyl)-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 8504178 |
| Molecular Formula | C18H18F3N4O3+ |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | (3-methyl-4-nitrophenyl)-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCN(c3ccc(C(F)(F)F)c[nH+]3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17F3N4O3/c1-12-10-13(2-4-15(12)25(27)28)17(26)24-8-6-23(7-9-24)16-5-3-14(11-22-16)18(19,20)21/h2-5,10-11H,6-9H2,1H3/p+1 |
| InChIKey | OIUZHTXQTKXUCD-UHFFFAOYSA-O |
| XLogP | 2.70 |
| TPSA | 80.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|