C50H74O26 — CID 85048743
[6-[[5-(2-oxobutyl)-3,4-di(propanoyloxy)-6-[2,3,4,5-tetra(propanoyloxy)oxolan-2-yl]oxyoxan-2-yl]methoxy]-3,4,5-tri(propanoyloxy)oxan-2-yl]methyl propanoate (PubChem CID 85048743) has the molecular formula C50H74O26 and a molecular weight of 1091.12 g/mol. Its IUPAC name is [6-[[5-(2-oxobutyl)-3,4-di(propanoyloxy)-6-[2,3,4,5-tetra(propanoyloxy)oxolan-2-yl]oxyoxan-2-yl]methoxy]-3,4,5-tri(propanoyloxy)oxan-2-yl]methyl propanoate.
| Compound Name | [6-[[5-(2-oxobutyl)-3,4-di(propanoyloxy)-6-[2,3,4,5-tetra(propanoyloxy)oxolan-2-yl]oxyoxan-2-yl]methoxy]-3,4,5-tri(propanoyloxy)oxan-2-yl]methyl propanoate |
|---|---|
| PubChem CID | 85048743 |
| Molecular Formula | C50H74O26 |
| Molecular Weight | 1091.12 g/mol |
| Exact Mass | 1090.45 |
| IUPAC Name | [6-[[5-(2-oxobutyl)-3,4-di(propanoyloxy)-6-[2,3,4,5-tetra(propanoyloxy)oxolan-2-yl]oxyoxan-2-yl]methoxy]-3,4,5-tri(propanoyloxy)oxan-2-yl]methyl propanoate |
| SMILES | CCC(=O)CC1C(OC2(OC(=O)CC)OC(OC(=O)CC)C(OC(=O)CC)C2OC(=O)CC)OC(COC2OC(COC(=O)CC)C(OC(=O)CC)C(OC(=O)CC)C2OC(=O)CC)C(OC(=O)CC)C1OC(=O)CC |
| InChI | InChI=1S/C50H74O26/c1-12-26(51)23-27-40(66-31(53)14-3)41(67-32(54)15-4)29(25-63-48-44(70-35(57)18-7)43(69-34(56)17-6)42(68-33(55)16-5)28(65-48)24-62-30(52)13-2)64-47(27)75-50(74-39(61)22-11)46(72-37(59)20-9)45(71-36(58)19-8)49(76-50)73-38(60)21-10/h27-29,40-49H,12-25H2,1-11H3 |
| InChIKey | PXJGDANGHIMRRK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 326.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 26 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1091.12 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 26 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|