C17H24N2O2 — CID 85049354
7-[4-(dimethylamino)phenyl]-N-hydroxy-4,6-dimethylhepta-2,4-dienamide (PubChem CID 85049354) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 7-[4-(dimethylamino)phenyl]-N-hydroxy-4,6-dimethylhepta-2,4-dienamide.
| Compound Name | 7-[4-(dimethylamino)phenyl]-N-hydroxy-4,6-dimethylhepta-2,4-dienamide |
|---|---|
| PubChem CID | 85049354 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 7-[4-(dimethylamino)phenyl]-N-hydroxy-4,6-dimethylhepta-2,4-dienamide |
| SMILES | CC(C=CC(=O)NO)=CC(C)Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C17H24N2O2/c1-13(5-10-17(20)18-21)11-14(2)12-15-6-8-16(9-7-15)19(3)4/h5-11,14,21H,12H2,1-4H3,(H,18,20) |
| InChIKey | PXMPYCKSEDLABE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|