C16H22N2O2S — CID 10402906
(2E,4E)-6-[4-(dimethylamino)phenyl]sulfanyl-N-hydroxy-4-methylhepta-2,4-dienamide (PubChem CID 10402906) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is (2E,4E)-6-[4-(dimethylamino)phenyl]sulfanyl-N-hydroxy-4-methylhepta-2,4-dienamide.
| Compound Name | (2E,4E)-6-[4-(dimethylamino)phenyl]sulfanyl-N-hydroxy-4-methylhepta-2,4-dienamide |
|---|---|
| PubChem CID | 10402906 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (2E,4E)-6-[4-(dimethylamino)phenyl]sulfanyl-N-hydroxy-4-methylhepta-2,4-dienamide |
| SMILES | CC(/C=C/C(=O)NO)=C\C(C)Sc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C16H22N2O2S/c1-12(5-10-16(19)17-20)11-13(2)21-15-8-6-14(7-9-15)18(3)4/h5-11,13,20H,1-4H3,(H,17,19)/b10-5+,12-11+ |
| InChIKey | RTUXHWGTLOLXLW-WKWSCTOISA-N |
| XLogP | 3.24 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|