C18H25NO2S — CID 73067185
ethyl 6-[4-(dimethylamino)phenyl]sulfanyl-4-methylhepta-2,4-dienoate (PubChem CID 73067185) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is ethyl 6-[4-(dimethylamino)phenyl]sulfanyl-4-methylhepta-2,4-dienoate.
| Compound Name | ethyl 6-[4-(dimethylamino)phenyl]sulfanyl-4-methylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 73067185 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | ethyl 6-[4-(dimethylamino)phenyl]sulfanyl-4-methylhepta-2,4-dienoate |
| SMILES | CCOC(=O)C=CC(C)=CC(C)Sc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C18H25NO2S/c1-6-21-18(20)12-7-14(2)13-15(3)22-17-10-8-16(9-11-17)19(4)5/h7-13,15H,6H2,1-5H3 |
| InChIKey | FPBOWXDSZYQACY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|